5-{[5-(2,4-dichlorophenyl)furan-2-yl]methylidene}-3-(prop-2-en-1-yl)-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-{[5-(2,4-dichlorophenyl)furan-2-yl]methylidene}-3-(prop-2-en-1-yl)-2-sulfanylidene-1,3-thiazolidin-4-one
5-{[5-(2,4-dichlorophenyl)furan-2-yl]methylidene}-3-(prop-2-en-1-yl)-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3229-0230 |
| Compound Name: | 5-{[5-(2,4-dichlorophenyl)furan-2-yl]methylidene}-3-(prop-2-en-1-yl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 396.31 |
| Molecular Formula: | C17 H11 Cl2 N O2 S2 |
| Smiles: | C=CCN1C(/C(=C\c2ccc(c3ccc(cc3[Cl])[Cl])o2)SC1=S)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6878 |
| logD: | 5.6878 |
| logSw: | -6.0834 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 24.2621 |
| InChI Key: | YAUYCPRAZZEAFT-UHFFFAOYSA-N |