5-[(3-bromo-4-methoxyphenyl)methylidene]-3-(3-chlorophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-[(3-bromo-4-methoxyphenyl)methylidene]-3-(3-chlorophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one
5-[(3-bromo-4-methoxyphenyl)methylidene]-3-(3-chlorophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3229-0361 |
| Compound Name: | 5-[(3-bromo-4-methoxyphenyl)methylidene]-3-(3-chlorophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 440.76 |
| Molecular Formula: | C17 H11 Br Cl N O2 S2 |
| Smiles: | COc1ccc(\C=C2/C(N(C(=S)S2)c2cccc(c2)[Cl])=O)cc1[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.9403 |
| logD: | 4.9403 |
| logSw: | -5.1547 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 23.4613 |
| InChI Key: | CCWRMQPQVYNIBS-UHFFFAOYSA-N |