6-[2-({2-[(4-chlorophenyl)sulfanyl]phenyl}methylidene)hydrazinyl]-N~2~,N~4~-diphenyl-1,3,5-triazine-2,4-diamine
Chemical Structure Depiction of
6-[2-({2-[(4-chlorophenyl)sulfanyl]phenyl}methylidene)hydrazinyl]-N~2~,N~4~-diphenyl-1,3,5-triazine-2,4-diamine
6-[2-({2-[(4-chlorophenyl)sulfanyl]phenyl}methylidene)hydrazinyl]-N~2~,N~4~-diphenyl-1,3,5-triazine-2,4-diamine
Compound characteristics
| Compound ID: | 3229-0533 |
| Compound Name: | 6-[2-({2-[(4-chlorophenyl)sulfanyl]phenyl}methylidene)hydrazinyl]-N~2~,N~4~-diphenyl-1,3,5-triazine-2,4-diamine |
| Molecular Weight: | 524.05 |
| Molecular Formula: | C28 H22 Cl N7 S |
| Smiles: | C(\c1ccccc1Sc1ccc(cc1)[Cl])=N/Nc1nc(Nc2ccccc2)nc(Nc2ccccc2)n1 |
| Stereo: | ACHIRAL |
| logP: | 8.8454 |
| logD: | 8.8451 |
| logSw: | -7.0194 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 72.198 |
| InChI Key: | CIDRSIFKVFTYIM-UHFFFAOYSA-N |