5-({4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl}methylidene)-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-({4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl}methylidene)-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one
5-({4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl}methylidene)-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3229-0754 |
| Compound Name: | 5-({4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl}methylidene)-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 389.47 |
| Molecular Formula: | C19 H16 F N O3 S2 |
| Smiles: | CN1C(/C(=C\c2ccc(c(c2)OC)OCc2ccccc2F)SC1=S)=O |
| Stereo: | ACHIRAL |
| logP: | 3.688 |
| logD: | 3.688 |
| logSw: | -4.043 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 31.4242 |
| InChI Key: | NOOGINDOZXJFSG-UHFFFAOYSA-N |