3-ethyl-5-[3-(3-nitrophenyl)prop-2-en-1-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
3-ethyl-5-[3-(3-nitrophenyl)prop-2-en-1-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one
3-ethyl-5-[3-(3-nitrophenyl)prop-2-en-1-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3229-1183 |
| Compound Name: | 3-ethyl-5-[3-(3-nitrophenyl)prop-2-en-1-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 320.39 |
| Molecular Formula: | C14 H12 N2 O3 S2 |
| Smiles: | CCN1C(/C(=C\C=C\c2cccc(c2)[N+]([O-])=O)SC1=S)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6191 |
| logD: | 3.6191 |
| logSw: | -3.8007 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 49.82 |
| InChI Key: | UWQRIYAMLGNOLK-UHFFFAOYSA-N |