5-[(2,3-dichlorophenyl)methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one
					Chemical Structure Depiction of
5-[(2,3-dichlorophenyl)methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one
			5-[(2,3-dichlorophenyl)methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3229-1659 | 
| Compound Name: | 5-[(2,3-dichlorophenyl)methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one | 
| Molecular Weight: | 318.24 | 
| Molecular Formula: | C12 H9 Cl2 N O S2 | 
| Smiles: | CCN1C(/C(=C\c2cccc(c2[Cl])[Cl])SC1=S)=O | 
| Stereo: | ACHIRAL | 
| logP: | 4.4079 | 
| logD: | 4.4079 | 
| logSw: | -4.4138 | 
| Hydrogen bond acceptors count: | 5 | 
| Polar surface area: | 16.4386 | 
| InChI Key: | VXQCGFYXORIKSM-UHFFFAOYSA-N | 
 
				 
				