5-[(3-ethoxy-4-{2-[2-(4-methylphenoxy)ethoxy]ethoxy}phenyl)methylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-[(3-ethoxy-4-{2-[2-(4-methylphenoxy)ethoxy]ethoxy}phenyl)methylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one
5-[(3-ethoxy-4-{2-[2-(4-methylphenoxy)ethoxy]ethoxy}phenyl)methylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3229-1687 |
| Compound Name: | 5-[(3-ethoxy-4-{2-[2-(4-methylphenoxy)ethoxy]ethoxy}phenyl)methylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 535.68 |
| Molecular Formula: | C29 H29 N O5 S2 |
| Smiles: | CCOc1cc(\C=C2/C(N(C(=S)S2)c2ccccc2)=O)ccc1OCCOCCOc1ccc(C)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.3447 |
| logD: | 5.3447 |
| logSw: | -5.3481 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 45.963 |
| InChI Key: | YBQSFTLWJKECJK-UHFFFAOYSA-N |