5-[3-(2-chlorophenyl)prop-2-en-1-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-[3-(2-chlorophenyl)prop-2-en-1-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one
5-[3-(2-chlorophenyl)prop-2-en-1-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3229-1783 |
| Compound Name: | 5-[3-(2-chlorophenyl)prop-2-en-1-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 281.78 |
| Molecular Formula: | C12 H8 Cl N O S2 |
| Smiles: | C(=C\c1ccccc1[Cl])\C=C1/C(NC(=S)S1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7486 |
| logD: | -0.5271 |
| logSw: | -3.4087 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.9001 |
| InChI Key: | OIBGDBDCAZOJBH-UHFFFAOYSA-N |