5-({2-[(4-chlorophenyl)methoxy]phenyl}methylidene)-1,3-dimethyl-1,3-diazinane-2,4,6-trione
Chemical Structure Depiction of
5-({2-[(4-chlorophenyl)methoxy]phenyl}methylidene)-1,3-dimethyl-1,3-diazinane-2,4,6-trione
5-({2-[(4-chlorophenyl)methoxy]phenyl}methylidene)-1,3-dimethyl-1,3-diazinane-2,4,6-trione
Compound characteristics
| Compound ID: | 3229-2215 |
| Compound Name: | 5-({2-[(4-chlorophenyl)methoxy]phenyl}methylidene)-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| Molecular Weight: | 384.82 |
| Molecular Formula: | C20 H17 Cl N2 O4 |
| Smiles: | CN1C(C(=Cc2ccccc2OCc2ccc(cc2)[Cl])C(N(C)C1=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9965 |
| logD: | 3.9965 |
| logSw: | -4.4701 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 52.44 |
| InChI Key: | HBIDQKOOBYWCLQ-UHFFFAOYSA-N |