(2-ethoxy-4-{[2,4,6-trioxo-1-(prop-2-en-1-yl)-1,3-diazinan-5-ylidene]methyl}phenoxy)acetic acid
Chemical Structure Depiction of
(2-ethoxy-4-{[2,4,6-trioxo-1-(prop-2-en-1-yl)-1,3-diazinan-5-ylidene]methyl}phenoxy)acetic acid
(2-ethoxy-4-{[2,4,6-trioxo-1-(prop-2-en-1-yl)-1,3-diazinan-5-ylidene]methyl}phenoxy)acetic acid
Compound characteristics
| Compound ID: | 3229-2229 |
| Compound Name: | (2-ethoxy-4-{[2,4,6-trioxo-1-(prop-2-en-1-yl)-1,3-diazinan-5-ylidene]methyl}phenoxy)acetic acid |
| Molecular Weight: | 374.35 |
| Molecular Formula: | C18 H18 N2 O7 |
| Smiles: | CCOc1cc(/C=C2/C(NC(N(CC=C)C2=O)=O)=O)ccc1OCC(O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.9534 |
| logD: | -3.2836 |
| logSw: | -2.1118 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 97.432 |
| InChI Key: | VROUTNDTGJSDQT-UHFFFAOYSA-N |