5-({3,5-dibromo-4-[(prop-2-en-1-yl)oxy]phenyl}methylidene)-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-({3,5-dibromo-4-[(prop-2-en-1-yl)oxy]phenyl}methylidene)-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one
5-({3,5-dibromo-4-[(prop-2-en-1-yl)oxy]phenyl}methylidene)-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3229-2347 |
| Compound Name: | 5-({3,5-dibromo-4-[(prop-2-en-1-yl)oxy]phenyl}methylidene)-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
| Molecular Weight: | 579.25 |
| Molecular Formula: | C20 H12 Br2 F3 N O2 S2 |
| Smiles: | C=CCOc1c(cc(\C=C2/C(N(C(=S)S2)c2cccc(c2)C(F)(F)F)=O)cc1[Br])[Br] |
| Stereo: | ACHIRAL |
| logP: | 6.6487 |
| logD: | 6.6487 |
| logSw: | -6.3025 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 23.4219 |
| InChI Key: | KQNDSLDUTFZJOS-UHFFFAOYSA-N |