5-[(3-bromo-4-fluorophenyl)methylidene]-3-(3-chlorophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-[(3-bromo-4-fluorophenyl)methylidene]-3-(3-chlorophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one
5-[(3-bromo-4-fluorophenyl)methylidene]-3-(3-chlorophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3229-2349 |
| Compound Name: | 5-[(3-bromo-4-fluorophenyl)methylidene]-3-(3-chlorophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 428.73 |
| Molecular Formula: | C16 H8 Br Cl F N O S2 |
| Smiles: | C(=C1/C(N(C(=S)S1)c1cccc(c1)[Cl])=O)/c1ccc(c(c1)[Br])F |
| Stereo: | ACHIRAL |
| logP: | 5.1619 |
| logD: | 5.1619 |
| logSw: | -5.8162 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 15.8308 |
| InChI Key: | ZXWWKZCCZDGDLL-UHFFFAOYSA-N |