5-[(3-bromophenyl)methylidene]-3-(3-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-[(3-bromophenyl)methylidene]-3-(3-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one
5-[(3-bromophenyl)methylidene]-3-(3-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3229-2417 |
| Compound Name: | 5-[(3-bromophenyl)methylidene]-3-(3-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 421.29 |
| Molecular Formula: | C16 H9 Br N2 O3 S2 |
| Smiles: | C(=C1/C(N(C(=S)S1)c1cccc(c1)[N+]([O-])=O)=O)/c1cccc(c1)[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.6034 |
| logD: | 4.6034 |
| logSw: | -4.6144 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 49.212 |
| InChI Key: | LWBCXJCFBMKVLO-UHFFFAOYSA-N |