5-[(anthracen-9-yl)methylidene]-2-(phenylimino)-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-[(anthracen-9-yl)methylidene]-2-(phenylimino)-1,3-thiazolidin-4-one
5-[(anthracen-9-yl)methylidene]-2-(phenylimino)-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3229-2441 |
| Compound Name: | 5-[(anthracen-9-yl)methylidene]-2-(phenylimino)-1,3-thiazolidin-4-one |
| Molecular Weight: | 380.47 |
| Molecular Formula: | C24 H16 N2 O S |
| Smiles: | C(=C1/C(N\C(=N/c2ccccc2)S1)=O)/c1c2ccccc2cc2ccccc12 |
| Stereo: | ACHIRAL |
| logP: | 5.498 |
| logD: | 5.4961 |
| logSw: | -6.9233 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.61 |
| InChI Key: | LMSIZDUBSBTGNW-UHFFFAOYSA-N |