3-(4-chlorophenyl)-5-{[4-(dimethylamino)phenyl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
3-(4-chlorophenyl)-5-{[4-(dimethylamino)phenyl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one
3-(4-chlorophenyl)-5-{[4-(dimethylamino)phenyl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3229-2790 |
| Compound Name: | 3-(4-chlorophenyl)-5-{[4-(dimethylamino)phenyl]methylidene}-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 374.91 |
| Molecular Formula: | C18 H15 Cl N2 O S2 |
| Smiles: | CN(C)c1ccc(\C=C2/C(N(C(=S)S2)c2ccc(cc2)[Cl])=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.6306 |
| logD: | 4.6305 |
| logSw: | -5.0867 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 18.6356 |
| InChI Key: | IERITWGUNZICFR-UHFFFAOYSA-N |