3-chloro-1-(3-chlorophenyl)-4-(2,3-dimethylanilino)-1H-pyrrole-2,5-dione
Chemical Structure Depiction of
3-chloro-1-(3-chlorophenyl)-4-(2,3-dimethylanilino)-1H-pyrrole-2,5-dione
3-chloro-1-(3-chlorophenyl)-4-(2,3-dimethylanilino)-1H-pyrrole-2,5-dione
Compound characteristics
| Compound ID: | 3230-2056 |
| Compound Name: | 3-chloro-1-(3-chlorophenyl)-4-(2,3-dimethylanilino)-1H-pyrrole-2,5-dione |
| Molecular Weight: | 361.23 |
| Molecular Formula: | C18 H14 Cl2 N2 O2 |
| Smiles: | Cc1cccc(c1C)NC1=C(C(N(C1=O)c1cccc(c1)[Cl])=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.512 |
| logD: | 4.5078 |
| logSw: | -4.5359 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.565 |
| InChI Key: | MKWZFSOGVOQOQK-UHFFFAOYSA-N |