ethyl 2-[2-(4-tert-butylphenoxy)acetamido]-4-methyl-1,3-thiazole-5-carboxylate
Chemical Structure Depiction of
ethyl 2-[2-(4-tert-butylphenoxy)acetamido]-4-methyl-1,3-thiazole-5-carboxylate
ethyl 2-[2-(4-tert-butylphenoxy)acetamido]-4-methyl-1,3-thiazole-5-carboxylate
Compound characteristics
| Compound ID: | 3232-0392 |
| Compound Name: | ethyl 2-[2-(4-tert-butylphenoxy)acetamido]-4-methyl-1,3-thiazole-5-carboxylate |
| Molecular Weight: | 376.47 |
| Molecular Formula: | C19 H24 N2 O4 S |
| Smiles: | CCOC(c1c(C)nc(NC(COc2ccc(cc2)C(C)(C)C)=O)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9691 |
| logD: | 4.9128 |
| logSw: | -4.5212 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.992 |
| InChI Key: | FSPXDJIIHHNUIN-UHFFFAOYSA-N |