5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one
5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 3232-1180 |
| Compound Name: | 5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 295.38 |
| Molecular Formula: | C13 H13 N O3 S2 |
| Smiles: | CCOc1cc(\C=C2/C(N(C)C(=S)S2)=O)ccc1O |
| Stereo: | ACHIRAL |
| logP: | 2.1739 |
| logD: | 2.1714 |
| logSw: | -2.5365 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.238 |
| InChI Key: | KWGJAFWTNWDIET-UHFFFAOYSA-N |