ethyl 2-{2-[(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)sulfanyl]acetamido}-4,5-dimethylthiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 2-{2-[(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)sulfanyl]acetamido}-4,5-dimethylthiophene-3-carboxylate
ethyl 2-{2-[(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)sulfanyl]acetamido}-4,5-dimethylthiophene-3-carboxylate
Compound characteristics
| Compound ID: | 3232-1784 |
| Compound Name: | ethyl 2-{2-[(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)sulfanyl]acetamido}-4,5-dimethylthiophene-3-carboxylate |
| Molecular Weight: | 384.43 |
| Molecular Formula: | C14 H16 N4 O5 S2 |
| Smiles: | CCOC(c1c(C)c(C)sc1NC(CSC1C(NC(NN=1)=O)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.1366 |
| logD: | -0.8909 |
| logSw: | -1.7946 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 104.752 |
| InChI Key: | VZAKKBGCDGRZNT-UHFFFAOYSA-N |