2-bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,4,5-trimethoxybenzamide
Chemical Structure Depiction of
2-bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,4,5-trimethoxybenzamide
2-bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,4,5-trimethoxybenzamide
Compound characteristics
| Compound ID: | 3232-1858 |
| Compound Name: | 2-bromo-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,4,5-trimethoxybenzamide |
| Molecular Weight: | 424.25 |
| Molecular Formula: | C18 H18 Br N O6 |
| Smiles: | COc1cc(C(Nc2ccc3c(c2)OCCO3)=O)c(c(c1OC)OC)[Br] |
| Stereo: | ACHIRAL |
| logP: | 2.7771 |
| logD: | 2.7767 |
| logSw: | -3.4671 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.217 |
| InChI Key: | HWGLSUOHZHVNMM-UHFFFAOYSA-N |