N'-{1-[(dimethylamino)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}-4-methoxybenzohydrazide
Chemical Structure Depiction of
N'-{1-[(dimethylamino)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}-4-methoxybenzohydrazide
N'-{1-[(dimethylamino)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}-4-methoxybenzohydrazide
Compound characteristics
| Compound ID: | 3235-0021 |
| Compound Name: | N'-{1-[(dimethylamino)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}-4-methoxybenzohydrazide |
| Molecular Weight: | 352.39 |
| Molecular Formula: | C19 H20 N4 O3 |
| Smiles: | CN(C)CN1C(C(\c2ccccc12)=N/NC(c1ccc(cc1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3876 |
| logD: | 1.9737 |
| logSw: | -2.8512 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.714 |
| InChI Key: | FQQCDTZGDRJRER-UHFFFAOYSA-N |