N'-{5-bromo-1-[(dipropylamino)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}-2-(3,4-dimethoxyphenyl)acetohydrazide
Chemical Structure Depiction of
N'-{5-bromo-1-[(dipropylamino)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}-2-(3,4-dimethoxyphenyl)acetohydrazide
N'-{5-bromo-1-[(dipropylamino)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}-2-(3,4-dimethoxyphenyl)acetohydrazide
Compound characteristics
| Compound ID: | 3235-0171 |
| Compound Name: | N'-{5-bromo-1-[(dipropylamino)methyl]-2-oxo-1,2-dihydro-3H-indol-3-ylidene}-2-(3,4-dimethoxyphenyl)acetohydrazide |
| Molecular Weight: | 531.45 |
| Molecular Formula: | C25 H31 Br N4 O4 |
| Smiles: | CCCN(CCC)CN1C(C(\c2cc(ccc12)[Br])=N/NC(Cc1ccc(c(c1)OC)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5959 |
| logD: | 3.9401 |
| logSw: | -4.3132 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.271 |
| InChI Key: | OUGWAZJHASMNGR-UHFFFAOYSA-N |