2-benzyl-5-(4-methylphenyl)-4H-thieno[2,3-d][1,3]oxazin-4-one
Chemical Structure Depiction of
2-benzyl-5-(4-methylphenyl)-4H-thieno[2,3-d][1,3]oxazin-4-one
2-benzyl-5-(4-methylphenyl)-4H-thieno[2,3-d][1,3]oxazin-4-one
Compound characteristics
| Compound ID: | 3237-0879 |
| Compound Name: | 2-benzyl-5-(4-methylphenyl)-4H-thieno[2,3-d][1,3]oxazin-4-one |
| Molecular Weight: | 333.41 |
| Molecular Formula: | C20 H15 N O2 S |
| Smiles: | Cc1ccc(cc1)c1csc2c1C(=O)OC(Cc1ccccc1)=N2 |
| Stereo: | ACHIRAL |
| logP: | 4.9267 |
| logD: | 4.9267 |
| logSw: | -4.8641 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 29.9623 |
| InChI Key: | GZXAVXPFMGYSNZ-UHFFFAOYSA-N |