7-[(2-chlorophenyl)methyl]-8-(3,5-dimethylpiperidin-1-yl)-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione
Chemical Structure Depiction of
7-[(2-chlorophenyl)methyl]-8-(3,5-dimethylpiperidin-1-yl)-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione
7-[(2-chlorophenyl)methyl]-8-(3,5-dimethylpiperidin-1-yl)-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione
Compound characteristics
| Compound ID: | 3238-0116 |
| Compound Name: | 7-[(2-chlorophenyl)methyl]-8-(3,5-dimethylpiperidin-1-yl)-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione |
| Molecular Weight: | 415.92 |
| Molecular Formula: | C21 H26 Cl N5 O2 |
| Smiles: | CC1CC(C)CN(C1)c1nc2c(C(N(C)C(N2C)=O)=O)n1Cc1ccccc1[Cl] |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.9268 |
| logD: | 4.9268 |
| logSw: | -4.8203 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 45.564 |
| InChI Key: | MNPOCBFWNJHZHJ-UHFFFAOYSA-N |