N'-[(2-methoxyphenyl)methylidene]pyridine-3-carbohydrazide
Chemical Structure Depiction of
N'-[(2-methoxyphenyl)methylidene]pyridine-3-carbohydrazide
N'-[(2-methoxyphenyl)methylidene]pyridine-3-carbohydrazide
Compound characteristics
| Compound ID: | 3253-0064 |
| Compound Name: | N'-[(2-methoxyphenyl)methylidene]pyridine-3-carbohydrazide |
| Molecular Weight: | 255.27 |
| Molecular Formula: | C14 H13 N3 O2 |
| Smiles: | COc1ccccc1/C=N/NC(c1cccnc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1827 |
| logD: | 2.1781 |
| logSw: | -2.2111 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.702 |
| InChI Key: | GHRIBYXAIFMVFK-UHFFFAOYSA-N |