N'-[1-(4-nitrophenyl)ethylidene]pyridine-2-carbohydrazide
Chemical Structure Depiction of
N'-[1-(4-nitrophenyl)ethylidene]pyridine-2-carbohydrazide
N'-[1-(4-nitrophenyl)ethylidene]pyridine-2-carbohydrazide
Compound characteristics
| Compound ID: | 3253-0342 |
| Compound Name: | N'-[1-(4-nitrophenyl)ethylidene]pyridine-2-carbohydrazide |
| Molecular Weight: | 284.27 |
| Molecular Formula: | C14 H12 N4 O3 |
| Smiles: | C/C(c1ccc(cc1)[N+]([O-])=O)=N/NC(c1ccccn1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2619 |
| logD: | 2.2418 |
| logSw: | -2.6149 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.271 |
| InChI Key: | BVXAUXSGCXSOGZ-UHFFFAOYSA-N |