N'-[1-(furan-2-yl)ethylidene]thiophene-2-carbohydrazide
Chemical Structure Depiction of
N'-[1-(furan-2-yl)ethylidene]thiophene-2-carbohydrazide
N'-[1-(furan-2-yl)ethylidene]thiophene-2-carbohydrazide
Compound characteristics
| Compound ID: | 3253-0398 |
| Compound Name: | N'-[1-(furan-2-yl)ethylidene]thiophene-2-carbohydrazide |
| Molecular Weight: | 234.27 |
| Molecular Formula: | C11 H10 N2 O2 S |
| Smiles: | C\C(c1ccco1)=N/NC(c1cccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3238 |
| logD: | 2.3236 |
| logSw: | -2.6826 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.439 |
| InChI Key: | NEGZLVDLFUDVRT-UHFFFAOYSA-N |