N-(3,5-dimethyl-4H-1,2,4-triazol-4-yl)-1-(2-methoxyphenyl)methanimine
Chemical Structure Depiction of
N-(3,5-dimethyl-4H-1,2,4-triazol-4-yl)-1-(2-methoxyphenyl)methanimine
N-(3,5-dimethyl-4H-1,2,4-triazol-4-yl)-1-(2-methoxyphenyl)methanimine
Compound characteristics
| Compound ID: | 3253-0845 |
| Compound Name: | N-(3,5-dimethyl-4H-1,2,4-triazol-4-yl)-1-(2-methoxyphenyl)methanimine |
| Molecular Weight: | 230.27 |
| Molecular Formula: | C12 H14 N4 O |
| Smiles: | Cc1nnc(C)n1/N=C/c1ccccc1OC |
| Stereo: | ACHIRAL |
| logP: | 1.087 |
| logD: | 1.0863 |
| logSw: | -1.7622 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 44.479 |
| InChI Key: | AQGGGHOVVJVZHF-UHFFFAOYSA-N |