N'-[(2,3-dimethoxyphenyl)methylidene]pyrazine-2-carbohydrazide
Chemical Structure Depiction of
N'-[(2,3-dimethoxyphenyl)methylidene]pyrazine-2-carbohydrazide
N'-[(2,3-dimethoxyphenyl)methylidene]pyrazine-2-carbohydrazide
Compound characteristics
| Compound ID: | 3253-0885 |
| Compound Name: | N'-[(2,3-dimethoxyphenyl)methylidene]pyrazine-2-carbohydrazide |
| Molecular Weight: | 286.29 |
| Molecular Formula: | C14 H14 N4 O3 |
| Smiles: | COc1cccc(\C=N/NC(c2cnccn2)=O)c1OC |
| Stereo: | ACHIRAL |
| logP: | 1.3712 |
| logD: | 1.368 |
| logSw: | -1.3973 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.467 |
| InChI Key: | BURIFANWPNGURI-UHFFFAOYSA-N |