1-[4-(propan-2-yl)phenyl]-N-[4-(pyridin-2-yl)piperazin-1-yl]methanimine
Chemical Structure Depiction of
1-[4-(propan-2-yl)phenyl]-N-[4-(pyridin-2-yl)piperazin-1-yl]methanimine
1-[4-(propan-2-yl)phenyl]-N-[4-(pyridin-2-yl)piperazin-1-yl]methanimine
Compound characteristics
| Compound ID: | 3253-1189 |
| Compound Name: | 1-[4-(propan-2-yl)phenyl]-N-[4-(pyridin-2-yl)piperazin-1-yl]methanimine |
| Molecular Weight: | 308.42 |
| Molecular Formula: | C19 H24 N4 |
| Smiles: | CC(C)c1ccc(/C=N/N2CCN(CC2)c2ccccn2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.4115 |
| logD: | 4.3873 |
| logSw: | -4.1679 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 25.0773 |
| InChI Key: | VYAOOOPDXHONER-UHFFFAOYSA-N |