N-[4-(4-chlorophenyl)piperazin-1-yl]-1-(2,4-dimethoxyphenyl)methanimine
Chemical Structure Depiction of
N-[4-(4-chlorophenyl)piperazin-1-yl]-1-(2,4-dimethoxyphenyl)methanimine
N-[4-(4-chlorophenyl)piperazin-1-yl]-1-(2,4-dimethoxyphenyl)methanimine
Compound characteristics
| Compound ID: | 3253-1239 |
| Compound Name: | N-[4-(4-chlorophenyl)piperazin-1-yl]-1-(2,4-dimethoxyphenyl)methanimine |
| Molecular Weight: | 359.85 |
| Molecular Formula: | C19 H22 Cl N3 O2 |
| Smiles: | COc1ccc(\C=N/N2CCN(CC2)c2ccc(cc2)[Cl])c(c1)OC |
| Stereo: | ACHIRAL |
| logP: | 4.4753 |
| logD: | 4.4753 |
| logSw: | -4.6848 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 31.74 |
| InChI Key: | AFDKAGABVFBRLL-UHFFFAOYSA-N |