2-(1H-benzimidazol-1-yl)-N'-(2-methyl-3-phenylprop-2-en-1-ylidene)acetohydrazide
Chemical Structure Depiction of
2-(1H-benzimidazol-1-yl)-N'-(2-methyl-3-phenylprop-2-en-1-ylidene)acetohydrazide
2-(1H-benzimidazol-1-yl)-N'-(2-methyl-3-phenylprop-2-en-1-ylidene)acetohydrazide
Compound characteristics
| Compound ID: | 3253-1489 |
| Compound Name: | 2-(1H-benzimidazol-1-yl)-N'-(2-methyl-3-phenylprop-2-en-1-ylidene)acetohydrazide |
| Molecular Weight: | 318.38 |
| Molecular Formula: | C19 H18 N4 O |
| Smiles: | C/C(=C\c1ccccc1)/C=N/NC(Cn1cnc2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3351 |
| logD: | 3.3308 |
| logSw: | -3.4627 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.797 |
| InChI Key: | POAAROIRKSJBID-UHFFFAOYSA-N |