N'-[(3-hydroxyphenyl)methylidene]-4,5,6,7-tetrahydro-1H-indazole-3-carbohydrazide
Chemical Structure Depiction of
N'-[(3-hydroxyphenyl)methylidene]-4,5,6,7-tetrahydro-1H-indazole-3-carbohydrazide
N'-[(3-hydroxyphenyl)methylidene]-4,5,6,7-tetrahydro-1H-indazole-3-carbohydrazide
Compound characteristics
| Compound ID: | 3253-1815 |
| Compound Name: | N'-[(3-hydroxyphenyl)methylidene]-4,5,6,7-tetrahydro-1H-indazole-3-carbohydrazide |
| Molecular Weight: | 284.32 |
| Molecular Formula: | C15 H16 N4 O2 |
| Smiles: | C1CCc2c(C1)c(C(N/N=C/c1cccc(c1)O)=O)n[nH]2 |
| Stereo: | ACHIRAL |
| logP: | 2.1777 |
| logD: | 2.1756 |
| logSw: | -2.5016 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 78.124 |
| InChI Key: | YINUSXMYVSVDGF-UHFFFAOYSA-N |