3-phenyl-N-(4H-1,2,4-triazol-4-yl)prop-2-en-1-imine
Chemical Structure Depiction of
3-phenyl-N-(4H-1,2,4-triazol-4-yl)prop-2-en-1-imine
3-phenyl-N-(4H-1,2,4-triazol-4-yl)prop-2-en-1-imine
Compound characteristics
| Compound ID: | 3253-2089 |
| Compound Name: | 3-phenyl-N-(4H-1,2,4-triazol-4-yl)prop-2-en-1-imine |
| Molecular Weight: | 198.22 |
| Molecular Formula: | C11 H10 N4 |
| Smiles: | C(=C/c1ccccc1)\C=N/n1cnnc1 |
| Stereo: | ACHIRAL |
| logP: | 1.2914 |
| logD: | 1.2913 |
| logSw: | -0.9181 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 34.838 |
| InChI Key: | HIQAKCUTUJDMGW-UHFFFAOYSA-N |