N'-[1-(4-aminophenyl)ethylidene]-3-(4-methylphenyl)-1H-pyrazole-5-carbohydrazide
Chemical Structure Depiction of
N'-[1-(4-aminophenyl)ethylidene]-3-(4-methylphenyl)-1H-pyrazole-5-carbohydrazide
N'-[1-(4-aminophenyl)ethylidene]-3-(4-methylphenyl)-1H-pyrazole-5-carbohydrazide
Compound characteristics
| Compound ID: | 3253-2720 |
| Compound Name: | N'-[1-(4-aminophenyl)ethylidene]-3-(4-methylphenyl)-1H-pyrazole-5-carbohydrazide |
| Molecular Weight: | 333.39 |
| Molecular Formula: | C19 H19 N5 O |
| Smiles: | C\C(c1ccc(cc1)N)=N/NC(c1cc(c2ccc(C)cc2)n[nH]1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3339 |
| logD: | 3.3325 |
| logSw: | -3.5107 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 78.138 |
| InChI Key: | NJFKHAHVAVEWPC-UHFFFAOYSA-N |