2-[(1-methyl-1H-benzimidazol-2-yl)sulfanyl]-N'-[(thiophen-2-yl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-[(1-methyl-1H-benzimidazol-2-yl)sulfanyl]-N'-[(thiophen-2-yl)methylidene]acetohydrazide
2-[(1-methyl-1H-benzimidazol-2-yl)sulfanyl]-N'-[(thiophen-2-yl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 3253-4620 |
| Compound Name: | 2-[(1-methyl-1H-benzimidazol-2-yl)sulfanyl]-N'-[(thiophen-2-yl)methylidene]acetohydrazide |
| Molecular Weight: | 330.43 |
| Molecular Formula: | C15 H14 N4 O S2 |
| Smiles: | Cn1c2ccccc2nc1SCC(N/N=C/c1cccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1838 |
| logD: | 3.1796 |
| logSw: | -3.2899 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.951 |
| InChI Key: | RDMKBLFCWUUYEL-UHFFFAOYSA-N |