1-(3-bromophenyl)-N-{4-[(4-chlorophenyl)methyl]piperazin-1-yl}methanimine
Chemical Structure Depiction of
1-(3-bromophenyl)-N-{4-[(4-chlorophenyl)methyl]piperazin-1-yl}methanimine
1-(3-bromophenyl)-N-{4-[(4-chlorophenyl)methyl]piperazin-1-yl}methanimine
Compound characteristics
| Compound ID: | 3253-4731 |
| Compound Name: | 1-(3-bromophenyl)-N-{4-[(4-chlorophenyl)methyl]piperazin-1-yl}methanimine |
| Molecular Weight: | 392.72 |
| Molecular Formula: | C18 H19 Br Cl N3 |
| Smiles: | C1CN(CCN1Cc1ccc(cc1)[Cl])/N=C/c1cccc(c1)[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.6307 |
| logD: | 4.5594 |
| logSw: | -4.9573 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 16.8461 |
| InChI Key: | XRGFCAYXCJGNQJ-UHFFFAOYSA-N |