2-[(1-benzyl-1H-benzimidazol-2-yl)sulfanyl]-N'-[(2,3-dimethoxyphenyl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-[(1-benzyl-1H-benzimidazol-2-yl)sulfanyl]-N'-[(2,3-dimethoxyphenyl)methylidene]acetohydrazide
2-[(1-benzyl-1H-benzimidazol-2-yl)sulfanyl]-N'-[(2,3-dimethoxyphenyl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 3253-4834 |
| Compound Name: | 2-[(1-benzyl-1H-benzimidazol-2-yl)sulfanyl]-N'-[(2,3-dimethoxyphenyl)methylidene]acetohydrazide |
| Molecular Weight: | 460.55 |
| Molecular Formula: | C25 H24 N4 O3 S |
| Smiles: | COc1cccc(/C=N/NC(CSc2nc3ccccc3n2Cc2ccccc2)=O)c1OC |
| Stereo: | ACHIRAL |
| logP: | 5.1612 |
| logD: | 5.1608 |
| logSw: | -5.0938 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.199 |
| InChI Key: | PHYYLRFWYBSGHU-UHFFFAOYSA-N |