N,N-diethyl-4-{[(4-phenylpiperazin-1-yl)imino]methyl}aniline
Chemical Structure Depiction of
N,N-diethyl-4-{[(4-phenylpiperazin-1-yl)imino]methyl}aniline
N,N-diethyl-4-{[(4-phenylpiperazin-1-yl)imino]methyl}aniline
Compound characteristics
| Compound ID: | 3253-5216 |
| Compound Name: | N,N-diethyl-4-{[(4-phenylpiperazin-1-yl)imino]methyl}aniline |
| Molecular Weight: | 336.48 |
| Molecular Formula: | C21 H28 N4 |
| Smiles: | CCN(CC)c1ccc(\C=N/N2CCN(CC2)c2ccccc2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.2162 |
| logD: | 4.2135 |
| logSw: | -4.0379 |
| Hydrogen bond acceptors count: | 1 |
| Polar surface area: | 19.3022 |
| InChI Key: | VPKCGNGETILVFN-UHFFFAOYSA-N |