2-methyl-N-[4-(4-methylphenyl)piperazin-1-yl]-3-phenylprop-2-en-1-imine
Chemical Structure Depiction of
2-methyl-N-[4-(4-methylphenyl)piperazin-1-yl]-3-phenylprop-2-en-1-imine
2-methyl-N-[4-(4-methylphenyl)piperazin-1-yl]-3-phenylprop-2-en-1-imine
Compound characteristics
| Compound ID: | 3253-5381 |
| Compound Name: | 2-methyl-N-[4-(4-methylphenyl)piperazin-1-yl]-3-phenylprop-2-en-1-imine |
| Molecular Weight: | 319.45 |
| Molecular Formula: | C21 H25 N3 |
| Smiles: | C/C(=C\c1ccccc1)\C=N/N1CCN(CC1)c1ccc(C)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.3006 |
| logD: | 5.3001 |
| logSw: | -5.4648 |
| Hydrogen bond acceptors count: | 1 |
| Polar surface area: | 16.566 |
| InChI Key: | RHRBXTOQVQIRPX-UHFFFAOYSA-N |