N'-[(4-fluorophenyl)methylidene]-2-{[5-(4-methylphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}acetohydrazide
Chemical Structure Depiction of
N'-[(4-fluorophenyl)methylidene]-2-{[5-(4-methylphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}acetohydrazide
N'-[(4-fluorophenyl)methylidene]-2-{[5-(4-methylphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}acetohydrazide
Compound characteristics
| Compound ID: | 3253-5648 |
| Compound Name: | N'-[(4-fluorophenyl)methylidene]-2-{[5-(4-methylphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}acetohydrazide |
| Molecular Weight: | 445.52 |
| Molecular Formula: | C24 H20 F N5 O S |
| Smiles: | Cc1ccc(cc1)c1nnc(n1c1ccccc1)SCC(N/N=C\c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9425 |
| logD: | 4.9423 |
| logSw: | -4.6228 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.086 |
| InChI Key: | MZRMJQMNZJIJCR-UHFFFAOYSA-N |