N'-[(3,5-di-tert-butyl-4-hydroxyphenyl)methylidene]-2-{[5-(4-methylphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}acetohydrazide
Chemical Structure Depiction of
N'-[(3,5-di-tert-butyl-4-hydroxyphenyl)methylidene]-2-{[5-(4-methylphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}acetohydrazide
N'-[(3,5-di-tert-butyl-4-hydroxyphenyl)methylidene]-2-{[5-(4-methylphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}acetohydrazide
Compound characteristics
| Compound ID: | 3253-5696 |
| Compound Name: | N'-[(3,5-di-tert-butyl-4-hydroxyphenyl)methylidene]-2-{[5-(4-methylphenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}acetohydrazide |
| Molecular Weight: | 555.74 |
| Molecular Formula: | C32 H37 N5 O2 S |
| Smiles: | Cc1ccc(cc1)c1nnc(n1c1ccccc1)SCC(N/N=C\c1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 7.6047 |
| logD: | 7.6046 |
| logSw: | -5.4833 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 75.566 |
| InChI Key: | LXFUGOLHOKLWBI-UHFFFAOYSA-N |