N'-(2-chloro-3-phenylprop-2-en-1-ylidene)-4,5,6,7-tetrahydro-1H-indazole-3-carbohydrazide
Chemical Structure Depiction of
N'-(2-chloro-3-phenylprop-2-en-1-ylidene)-4,5,6,7-tetrahydro-1H-indazole-3-carbohydrazide
N'-(2-chloro-3-phenylprop-2-en-1-ylidene)-4,5,6,7-tetrahydro-1H-indazole-3-carbohydrazide
Compound characteristics
| Compound ID: | 3253-6450 |
| Compound Name: | N'-(2-chloro-3-phenylprop-2-en-1-ylidene)-4,5,6,7-tetrahydro-1H-indazole-3-carbohydrazide |
| Molecular Weight: | 328.8 |
| Molecular Formula: | C17 H17 Cl N4 O |
| Smiles: | C1CCc2c(C1)c(C(N/N=C\C(=C\c1ccccc1)[Cl])=O)n[nH]2 |
| Stereo: | ACHIRAL |
| logP: | 3.7826 |
| logD: | 3.7358 |
| logSw: | -4.3429 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 60.507 |
| InChI Key: | LTRKIYVLKKRAIK-UHFFFAOYSA-N |