2,6-dimethoxy-4-({2-[({1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}sulfanyl)acetyl]hydrazinylidene}methyl)phenyl acetate
Chemical Structure Depiction of
2,6-dimethoxy-4-({2-[({1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}sulfanyl)acetyl]hydrazinylidene}methyl)phenyl acetate
2,6-dimethoxy-4-({2-[({1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}sulfanyl)acetyl]hydrazinylidene}methyl)phenyl acetate
Compound characteristics
| Compound ID: | 3253-7490 |
| Compound Name: | 2,6-dimethoxy-4-({2-[({1-[(4-methylphenyl)methyl]-1H-benzimidazol-2-yl}sulfanyl)acetyl]hydrazinylidene}methyl)phenyl acetate |
| Molecular Weight: | 532.62 |
| Molecular Formula: | C28 H28 N4 O5 S |
| Smiles: | CC(=O)Oc1c(cc(/C=N/NC(CSc2nc3ccccc3n2Cc2ccc(C)cc2)=O)cc1OC)OC |
| Stereo: | ACHIRAL |
| logP: | 5.0238 |
| logD: | 5.0234 |
| logSw: | -4.7211 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.036 |
| InChI Key: | LYMSLRFUUJQECR-UHFFFAOYSA-N |