N'-[3-(2-methoxyphenyl)prop-2-en-1-ylidene]-2-(thiophen-2-yl)acetohydrazide
Chemical Structure Depiction of
N'-[3-(2-methoxyphenyl)prop-2-en-1-ylidene]-2-(thiophen-2-yl)acetohydrazide
N'-[3-(2-methoxyphenyl)prop-2-en-1-ylidene]-2-(thiophen-2-yl)acetohydrazide
Compound characteristics
| Compound ID: | 3253-7702 |
| Compound Name: | N'-[3-(2-methoxyphenyl)prop-2-en-1-ylidene]-2-(thiophen-2-yl)acetohydrazide |
| Molecular Weight: | 300.38 |
| Molecular Formula: | C16 H16 N2 O2 S |
| Smiles: | COc1ccccc1\C=C\C=N/NC(Cc1cccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6638 |
| logD: | 2.6633 |
| logSw: | -3.0207 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.621 |
| InChI Key: | SDXSOQIFFNIAGF-UHFFFAOYSA-N |