N'-[(4-methylphenyl)methylidene]-2-(1-methyl-1H-pyrrol-2-yl)acetohydrazide
Chemical Structure Depiction of
N'-[(4-methylphenyl)methylidene]-2-(1-methyl-1H-pyrrol-2-yl)acetohydrazide
N'-[(4-methylphenyl)methylidene]-2-(1-methyl-1H-pyrrol-2-yl)acetohydrazide
Compound characteristics
| Compound ID: | 3253-7775 |
| Compound Name: | N'-[(4-methylphenyl)methylidene]-2-(1-methyl-1H-pyrrol-2-yl)acetohydrazide |
| Molecular Weight: | 255.32 |
| Molecular Formula: | C15 H17 N3 O |
| Smiles: | Cc1ccc(\C=N/NC(Cc2cccn2C)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.7492 |
| logD: | 2.7485 |
| logSw: | -2.9043 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.238 |
| InChI Key: | GWWOPOHCBNIIAG-UHFFFAOYSA-N |