2,5-dimethyl-N'-[1-(naphthalen-2-yl)ethylidene]furan-3-carbohydrazide
Chemical Structure Depiction of
2,5-dimethyl-N'-[1-(naphthalen-2-yl)ethylidene]furan-3-carbohydrazide
2,5-dimethyl-N'-[1-(naphthalen-2-yl)ethylidene]furan-3-carbohydrazide
Compound characteristics
| Compound ID: | 3254-0032 |
| Compound Name: | 2,5-dimethyl-N'-[1-(naphthalen-2-yl)ethylidene]furan-3-carbohydrazide |
| Molecular Weight: | 306.36 |
| Molecular Formula: | C19 H18 N2 O2 |
| Smiles: | C/C(c1ccc2ccccc2c1)=N/NC(c1cc(C)oc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1962 |
| logD: | 4.1906 |
| logSw: | -4.3848 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.317 |
| InChI Key: | DEOMEBHENMPRGP-UHFFFAOYSA-N |