N'-[1-([1,1'-biphenyl]-4-yl)ethylidene]furan-2-carbohydrazide
Chemical Structure Depiction of
N'-[1-([1,1'-biphenyl]-4-yl)ethylidene]furan-2-carbohydrazide
N'-[1-([1,1'-biphenyl]-4-yl)ethylidene]furan-2-carbohydrazide
Compound characteristics
| Compound ID: | 3254-0245 |
| Compound Name: | N'-[1-([1,1'-biphenyl]-4-yl)ethylidene]furan-2-carbohydrazide |
| Molecular Weight: | 304.35 |
| Molecular Formula: | C19 H16 N2 O2 |
| Smiles: | C/C(c1ccc(cc1)c1ccccc1)=N/NC(c1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1701 |
| logD: | 4.1649 |
| logSw: | -4.388 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.149 |
| InChI Key: | HYCCIABDRXTNIB-UHFFFAOYSA-N |