2-{[5-(4-chlorophenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}-N'-[1-(2,4-dichlorophenyl)ethylidene]acetohydrazide
Chemical Structure Depiction of
2-{[5-(4-chlorophenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}-N'-[1-(2,4-dichlorophenyl)ethylidene]acetohydrazide
2-{[5-(4-chlorophenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}-N'-[1-(2,4-dichlorophenyl)ethylidene]acetohydrazide
Compound characteristics
| Compound ID: | 3254-0591 |
| Compound Name: | 2-{[5-(4-chlorophenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}-N'-[1-(2,4-dichlorophenyl)ethylidene]acetohydrazide |
| Molecular Weight: | 530.86 |
| Molecular Formula: | C24 H18 Cl3 N5 O S |
| Smiles: | C\C(c1ccc(cc1[Cl])[Cl])=N/NC(CSc1nnc(c2ccc(cc2)[Cl])n1c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.6075 |
| logD: | 6.6051 |
| logSw: | -6.1291 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.374 |
| InChI Key: | VDKKWPJLJKNJDC-UHFFFAOYSA-N |