2-(4-benzylpiperazin-1-yl)-N'-[(2,6-dichlorophenyl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-(4-benzylpiperazin-1-yl)-N'-[(2,6-dichlorophenyl)methylidene]acetohydrazide
2-(4-benzylpiperazin-1-yl)-N'-[(2,6-dichlorophenyl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 3254-2301 |
| Compound Name: | 2-(4-benzylpiperazin-1-yl)-N'-[(2,6-dichlorophenyl)methylidene]acetohydrazide |
| Molecular Weight: | 405.33 |
| Molecular Formula: | C20 H22 Cl2 N4 O |
| Smiles: | C1CN(CCN1CC(N/N=C\c1c(cccc1[Cl])[Cl])=O)Cc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 3.3511 |
| logD: | 3.1899 |
| logSw: | -3.3752 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.885 |
| InChI Key: | CLJAZXUVQMYHKE-UHFFFAOYSA-N |